C24H44O2Si2 — CID 134979332
(2E,4E,6E,8R,9S,10E)-9-[tert-butyl(dimethyl)silyl]oxy-2,4,6,8-tetramethyl-11-trimethylsilylundeca-2,4,6,10-tetraenal (PubChem CID 134979332) has the molecular formula C24H44O2Si2 and a molecular weight of 420.79 g/mol. Its IUPAC name is (2E,4E,6E,8R,9S,10E)-9-[tert-butyl(dimethyl)silyl]oxy-2,4,6,8-tetramethyl-11-trimethylsilylundeca-2,4,6,10-tetraenal.
| Compound Name | (2E,4E,6E,8R,9S,10E)-9-[tert-butyl(dimethyl)silyl]oxy-2,4,6,8-tetramethyl-11-trimethylsilylundeca-2,4,6,10-tetraenal |
|---|---|
| PubChem CID | 134979332 |
| Molecular Formula | C24H44O2Si2 |
| Molecular Weight | 420.79 g/mol |
| Exact Mass | 420.29 |
| IUPAC Name | (2E,4E,6E,8R,9S,10E)-9-[tert-butyl(dimethyl)silyl]oxy-2,4,6,8-tetramethyl-11-trimethylsilylundeca-2,4,6,10-tetraenal |
| SMILES | C/C(C=O)=C\C(C)=C\C(C)=C\[C@@H](C)[C@@H](/C=C/[Si](C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H44O2Si2/c1-19(16-21(3)18-25)15-20(2)17-22(4)23(13-14-27(8,9)10)26-28(11,12)24(5,6)7/h13-18,22-23H,1-12H3/b14-13+,19-15+,20-17+,21-16+/t22-,23-/m1/s1 |
| InChIKey | YBAQEMDUAWLBQA-PCPNUJMDSA-N |
| XLogP | 7.48 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.79 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|