About propan-2-yl (1R,6S)-1-formyl-6-methyl-3-trimethylsilyloxycyclohex-3-ene-1-carboxylate
propan-2-yl (1R,6S)-1-formyl-6-methyl-3-trimethylsilyloxycyclohex-3-ene-1-carboxylate (PubChem CID 134979342) has the molecular formula C15H26O4Si
and a molecular weight of 298.45 g/mol. Its IUPAC name is propan-2-yl (1R,6S)-1-formyl-6-methyl-3-trimethylsilyloxycyclohex-3-ene-1-carboxylate.
Molecular Properties
| Compound Name | propan-2-yl (1R,6S)-1-formyl-6-methyl-3-trimethylsilyloxycyclohex-3-ene-1-carboxylate |
| PubChem CID | 134979342 |
| Molecular Formula | C15H26O4Si |
| Molecular Weight | 298.45 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | propan-2-yl (1R,6S)-1-formyl-6-methyl-3-trimethylsilyloxycyclohex-3-ene-1-carboxylate |
| SMILES | CC(C)OC(=O)[C@]1(C=O)CC(O[Si](C)(C)C)=CC[C@@H]1C |
| InChI | InChI=1S/C15H26O4Si/c1-11(2)18-14(17)15(10-16)9-13(8-7-12(15)3)19-20(4,5)6/h8,10-12H,7,9H2,1-6H3/t12-,15-/m0/s1 |
| InChIKey | QVTURINVPUANLL-WFASDCNBSA-N |
| XLogP | 3.29 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.45 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yl (1R,6S)-1-formyl-6-methyl-3-trimethylsilyloxycyclohex-3-ene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl (1R,6S)-1-formyl-6-methyl-3-trimethylsilyloxycyclohex-3-ene-1-carboxylate?
The IUPAC name of propan-2-yl (1R,6S)-1-formyl-6-methyl-3-trimethylsilyloxycyclohex-3-ene-1-carboxylate (CID 134979342) is propan-2-yl (1R,6S)-1-formyl-6-methyl-3-trimethylsilyloxycyclohex-3-ene-1-carboxylate.
What is the SMILES notation for propan-2-yl (1R,6S)-1-formyl-6-methyl-3-trimethylsilyloxycyclohex-3-ene-1-carboxylate?
The canonical SMILES for propan-2-yl (1R,6S)-1-formyl-6-methyl-3-trimethylsilyloxycyclohex-3-ene-1-carboxylate is CC(C)OC(=O)[C@]1(C=O)CC(O[Si](C)(C)C)=CC[C@@H]1C.
What is the InChIKey of propan-2-yl (1R,6S)-1-formyl-6-methyl-3-trimethylsilyloxycyclohex-3-ene-1-carboxylate?
The InChIKey is QVTURINVPUANLL-WFASDCNBSA-N. The full InChI is InChI=1S/C15H26O4Si/c1-11(2)18-14(17)15(10-16)9-13(8-7-12(15)3)19-20(4,5)6/h8,10-12H,7,9H2,1-6H3/t12-,15-/m0/s1.
What are the key properties of propan-2-yl (1R,6S)-1-formyl-6-methyl-3-trimethylsilyloxycyclohex-3-ene-1-carboxylate?
propan-2-yl (1R,6S)-1-formyl-6-methyl-3-trimethylsilyloxycyclohex-3-ene-1-carboxylate has a molecular weight of 298.45 g/mol, XLogP of 3.29, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl (1R,6S)-1-formyl-6-methyl-3-trimethylsilyloxycyclohex-3-ene-1-carboxylate is sourced from PubChem (CID 134979342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).