C15H24O4 — CID 134979348
1-O'-tert-butyl 1-O-methyl (1R,6S)-3,6-dimethylcyclohex-3-ene-1,1-dicarboxylate (PubChem CID 134979348) has the molecular formula C15H24O4 and a molecular weight of 268.35 g/mol. Its IUPAC name is 1-O'-tert-butyl 1-O-methyl (1R,6S)-3,6-dimethylcyclohex-3-ene-1,1-dicarboxylate.
| Compound Name | 1-O'-tert-butyl 1-O-methyl (1R,6S)-3,6-dimethylcyclohex-3-ene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 134979348 |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | 1-O'-tert-butyl 1-O-methyl (1R,6S)-3,6-dimethylcyclohex-3-ene-1,1-dicarboxylate |
| SMILES | COC(=O)[C@@]1(C(=O)OC(C)(C)C)CC(C)=CC[C@@H]1C |
| InChI | InChI=1S/C15H24O4/c1-10-7-8-11(2)15(9-10,12(16)18-6)13(17)19-14(3,4)5/h7,11H,8-9H2,1-6H3/t11-,15+/m0/s1 |
| InChIKey | PECNDAVUCVMCOR-XHDPSFHLSA-N |
| XLogP | 2.86 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|