C11H10F7NO — CID 134979378
(1S,2S,3S,4R)-3-(1,1,2,2,3,3,3-heptafluoropropyl)bicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 134979378) has the molecular formula C11H10F7NO and a molecular weight of 305.19 g/mol. Its IUPAC name is (1S,2S,3S,4R)-3-(1,1,2,2,3,3,3-heptafluoropropyl)bicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | (1S,2S,3S,4R)-3-(1,1,2,2,3,3,3-heptafluoropropyl)bicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 134979378 |
| Molecular Formula | C11H10F7NO |
| Molecular Weight | 305.19 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | (1S,2S,3S,4R)-3-(1,1,2,2,3,3,3-heptafluoropropyl)bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | NC(=O)[C@@H]1[C@@H](C(F)(F)C(F)(F)C(F)(F)F)[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C11H10F7NO/c12-9(13,10(14,15)11(16,17)18)7-5-2-1-4(3-5)6(7)8(19)20/h1-2,4-7H,3H2,(H2,19,20)/t4-,5+,6+,7+/m1/s1 |
| InChIKey | LEIFNNHHUHWFHD-BWBBJGPYSA-N |
| XLogP | 2.74 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.19 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|