C27H54O8Si — CID 134979410
(2S,3R,4S,6S)-2-[(2S,3S,4R)-5-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-4-methylpentan-2-yl]-4-(2-methoxyethoxymethoxy)-3-methyl-1,7-dioxaspiro[5.5]undecan-9-ol (PubChem CID 134979410) has the molecular formula C27H54O8Si and a molecular weight of 534.81 g/mol. Its IUPAC name is (2S,3R,4S,6S)-2-[(2S,3S,4R)-5-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-4-methylpentan-2-yl]-4-(2-methoxyethoxymethoxy)-3-methyl-1,7-dioxaspiro[5.5]undecan-9-ol.
| Compound Name | (2S,3R,4S,6S)-2-[(2S,3S,4R)-5-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-4-methylpentan-2-yl]-4-(2-methoxyethoxymethoxy)-3-methyl-1,7-dioxaspiro[5.5]undecan-9-ol |
|---|---|
| PubChem CID | 134979410 |
| Molecular Formula | C27H54O8Si |
| Molecular Weight | 534.81 g/mol |
| Exact Mass | 534.36 |
| IUPAC Name | (2S,3R,4S,6S)-2-[(2S,3S,4R)-5-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-4-methylpentan-2-yl]-4-(2-methoxyethoxymethoxy)-3-methyl-1,7-dioxaspiro[5.5]undecan-9-ol |
| SMILES | COCCOCO[C@H]1C[C@]2(CCC(O)CO2)O[C@H]([C@@H](C)[C@@H](OC)[C@H](C)CO[Si](C)(C)C(C)(C)C)[C@@H]1C |
| InChI | InChI=1S/C27H54O8Si/c1-19(16-34-36(9,10)26(4,5)6)24(30-8)21(3)25-20(2)23(32-18-31-14-13-29-7)15-27(35-25)12-11-22(28)17-33-27/h19-25,28H,11-18H2,1-10H3/t19-,20-,21+,22?,23+,24+,25+,27+/m1/s1 |
| InChIKey | OTYURISITKITRR-WFONUQNTSA-N |
| XLogP | 4.59 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.81 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|