C17H23NO9 — CID 134979451
ethyl (3R,4R,5R,6S)-6-acetamido-3,4,5-triacetyloxycyclohexene-1-carboxylate (PubChem CID 134979451) has the molecular formula C17H23NO9 and a molecular weight of 385.37 g/mol. Its IUPAC name is ethyl (3R,4R,5R,6S)-6-acetamido-3,4,5-triacetyloxycyclohexene-1-carboxylate.
| Compound Name | ethyl (3R,4R,5R,6S)-6-acetamido-3,4,5-triacetyloxycyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 134979451 |
| Molecular Formula | C17H23NO9 |
| Molecular Weight | 385.37 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | ethyl (3R,4R,5R,6S)-6-acetamido-3,4,5-triacetyloxycyclohexene-1-carboxylate |
| SMILES | CCOC(=O)C1=C[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1NC(C)=O |
| InChI | InChI=1S/C17H23NO9/c1-6-24-17(23)12-7-13(25-9(3)20)15(26-10(4)21)16(27-11(5)22)14(12)18-8(2)19/h7,13-16H,6H2,1-5H3,(H,18,19)/t13-,14+,15-,16-/m1/s1 |
| InChIKey | RAEUMGDWUXSHHM-QKPAOTATSA-N |
| XLogP | -0.21 |
| TPSA | 134.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.37 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|