C19H32O7Si — CID 134979466
1-O'-tert-butyl 2-O-ethyl 1-O-methyl (1R,2S)-4-trimethylsilyloxycyclohex-4-ene-1,1,2-tricarboxylate (PubChem CID 134979466) has the molecular formula C19H32O7Si and a molecular weight of 400.54 g/mol. Its IUPAC name is 1-O'-tert-butyl 2-O-ethyl 1-O-methyl (1R,2S)-4-trimethylsilyloxycyclohex-4-ene-1,1,2-tricarboxylate.
| Compound Name | 1-O'-tert-butyl 2-O-ethyl 1-O-methyl (1R,2S)-4-trimethylsilyloxycyclohex-4-ene-1,1,2-tricarboxylate |
|---|---|
| PubChem CID | 134979466 |
| Molecular Formula | C19H32O7Si |
| Molecular Weight | 400.54 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | 1-O'-tert-butyl 2-O-ethyl 1-O-methyl (1R,2S)-4-trimethylsilyloxycyclohex-4-ene-1,1,2-tricarboxylate |
| SMILES | CCOC(=O)[C@H]1CC(O[Si](C)(C)C)=CC[C@@]1(C(=O)OC)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H32O7Si/c1-9-24-15(20)14-12-13(26-27(6,7)8)10-11-19(14,16(21)23-5)17(22)25-18(2,3)4/h10,14H,9,11-12H2,1-8H3/t14-,19-/m1/s1 |
| InChIKey | DTEHZNSGZKFMNO-AUUYWEPGSA-N |
| XLogP | 3.20 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.54 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|