About [[(1S,6S)-4,6-dimethylcyclohex-3-en-1-yl]-methoxymethylidene]chromium
[[(1S,6S)-4,6-dimethylcyclohex-3-en-1-yl]-methoxymethylidene]chromium (PubChem CID 134979472) has the molecular formula C10H16CrO
and a molecular weight of 204.23 g/mol. Its IUPAC name is [[(1S,6S)-4,6-dimethylcyclohex-3-en-1-yl]-methoxymethylidene]chromium.
Molecular Properties
| Compound Name | [[(1S,6S)-4,6-dimethylcyclohex-3-en-1-yl]-methoxymethylidene]chromium |
| PubChem CID | 134979472 |
| Molecular Formula | C10H16CrO |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | [[(1S,6S)-4,6-dimethylcyclohex-3-en-1-yl]-methoxymethylidene]chromium |
| SMILES | COC(=[Cr])[C@H]1CC=C(C)C[C@@H]1C |
| InChI | InChI=1S/C10H16O.Cr/c1-8-4-5-10(7-11-3)9(2)6-8;/h4,9-10H,5-6H2,1-3H3;/t9-,10+;/m0./s1 |
| InChIKey | FPTCLHLZZAQWBE-BAUSSPIASA-N |
| XLogP | 2.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [[(1S,6S)-4,6-dimethylcyclohex-3-en-1-yl]-methoxymethylidene]chromium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[(1S,6S)-4,6-dimethylcyclohex-3-en-1-yl]-methoxymethylidene]chromium?
The IUPAC name of [[(1S,6S)-4,6-dimethylcyclohex-3-en-1-yl]-methoxymethylidene]chromium (CID 134979472) is [[(1S,6S)-4,6-dimethylcyclohex-3-en-1-yl]-methoxymethylidene]chromium.
What is the SMILES notation for [[(1S,6S)-4,6-dimethylcyclohex-3-en-1-yl]-methoxymethylidene]chromium?
The canonical SMILES for [[(1S,6S)-4,6-dimethylcyclohex-3-en-1-yl]-methoxymethylidene]chromium is COC(=[Cr])[C@H]1CC=C(C)C[C@@H]1C.
What is the InChIKey of [[(1S,6S)-4,6-dimethylcyclohex-3-en-1-yl]-methoxymethylidene]chromium?
The InChIKey is FPTCLHLZZAQWBE-BAUSSPIASA-N. The full InChI is InChI=1S/C10H16O.Cr/c1-8-4-5-10(7-11-3)9(2)6-8;/h4,9-10H,5-6H2,1-3H3;/t9-,10+;/m0./s1.
What are the key properties of [[(1S,6S)-4,6-dimethylcyclohex-3-en-1-yl]-methoxymethylidene]chromium?
[[(1S,6S)-4,6-dimethylcyclohex-3-en-1-yl]-methoxymethylidene]chromium has a molecular weight of 204.23 g/mol, XLogP of 2.30, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [[(1S,6S)-4,6-dimethylcyclohex-3-en-1-yl]-methoxymethylidene]chromium is sourced from PubChem (CID 134979472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).