C13H22O3Si — CID 134979638
(3S,3aR,7R,7aS)-3,7-dimethyl-5-trimethylsilyloxy-3a,4,7,7a-tetrahydro-3H-2-benzofuran-1-one (PubChem CID 134979638) has the molecular formula C13H22O3Si and a molecular weight of 254.40 g/mol. Its IUPAC name is (3S,3aR,7R,7aS)-3,7-dimethyl-5-trimethylsilyloxy-3a,4,7,7a-tetrahydro-3H-2-benzofuran-1-one.
| Compound Name | (3S,3aR,7R,7aS)-3,7-dimethyl-5-trimethylsilyloxy-3a,4,7,7a-tetrahydro-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 134979638 |
| Molecular Formula | C13H22O3Si |
| Molecular Weight | 254.40 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | (3S,3aR,7R,7aS)-3,7-dimethyl-5-trimethylsilyloxy-3a,4,7,7a-tetrahydro-3H-2-benzofuran-1-one |
| SMILES | C[C@@H]1C=C(O[Si](C)(C)C)C[C@@H]2[C@H]1C(=O)O[C@H]2C |
| InChI | InChI=1S/C13H22O3Si/c1-8-6-10(16-17(3,4)5)7-11-9(2)15-13(14)12(8)11/h6,8-9,11-12H,7H2,1-5H3/t8-,9+,11+,12+/m1/s1 |
| InChIKey | IIGYWRXGNNHETH-QCZKYFFMSA-N |
| XLogP | 2.94 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.40 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|