C17H28O6Si — CID 134979665
2-O-ethyl 1-O-propan-2-yl (1R,2S)-1-formyl-4-trimethylsilyloxycyclohex-4-ene-1,2-dicarboxylate (PubChem CID 134979665) has the molecular formula C17H28O6Si and a molecular weight of 356.49 g/mol. Its IUPAC name is 2-O-ethyl 1-O-propan-2-yl (1R,2S)-1-formyl-4-trimethylsilyloxycyclohex-4-ene-1,2-dicarboxylate.
| Compound Name | 2-O-ethyl 1-O-propan-2-yl (1R,2S)-1-formyl-4-trimethylsilyloxycyclohex-4-ene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 134979665 |
| Molecular Formula | C17H28O6Si |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 2-O-ethyl 1-O-propan-2-yl (1R,2S)-1-formyl-4-trimethylsilyloxycyclohex-4-ene-1,2-dicarboxylate |
| SMILES | CCOC(=O)[C@H]1CC(O[Si](C)(C)C)=CC[C@@]1(C=O)C(=O)OC(C)C |
| InChI | InChI=1S/C17H28O6Si/c1-7-21-15(19)14-10-13(23-24(4,5)6)8-9-17(14,11-18)16(20)22-12(2)3/h8,11-12,14H,7,9-10H2,1-6H3/t14-,17+/m1/s1 |
| InChIKey | WTIDDVVSINJKEV-PBHICJAKSA-N |
| XLogP | 2.83 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|