C27H48OSi — CID 134979719
tri(propan-2-yl)-[[(1S,3E,7E,11R)-1,4,8-trimethyl-13-bicyclo[9.4.0]pentadeca-3,7,12-trienyl]oxy]silane (PubChem CID 134979719) has the molecular formula C27H48OSi and a molecular weight of 416.77 g/mol. Its IUPAC name is tri(propan-2-yl)-[[(1S,3E,7E,11R)-1,4,8-trimethyl-13-bicyclo[9.4.0]pentadeca-3,7,12-trienyl]oxy]silane.
| Compound Name | tri(propan-2-yl)-[[(1S,3E,7E,11R)-1,4,8-trimethyl-13-bicyclo[9.4.0]pentadeca-3,7,12-trienyl]oxy]silane |
|---|---|
| PubChem CID | 134979719 |
| Molecular Formula | C27H48OSi |
| Molecular Weight | 416.77 g/mol |
| Exact Mass | 416.35 |
| IUPAC Name | tri(propan-2-yl)-[[(1S,3E,7E,11R)-1,4,8-trimethyl-13-bicyclo[9.4.0]pentadeca-3,7,12-trienyl]oxy]silane |
| SMILES | C/C1=C\C[C@]2(C)CCC(O[Si](C(C)C)(C(C)C)C(C)C)=C[C@H]2CC/C(C)=C/CC1 |
| InChI | InChI=1S/C27H48OSi/c1-20(2)29(21(3)4,22(5)6)28-26-16-18-27(9)17-15-24(8)12-10-11-23(7)13-14-25(27)19-26/h11,15,19-22,25H,10,12-14,16-18H2,1-9H3/b23-11+,24-15+/t25-,27-/m1/s1 |
| InChIKey | UWKYYSZPPPPMCD-OWRZWDNHSA-N |
| XLogP | 9.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.77 |
| LogP ≤ 5 | 9.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|