About 15,15-dichlorooctaspiro[2.0.0.0.26.0.29.0.212.05.14.0.216.0.219.03]henicosane
15,15-dichlorooctaspiro[2.0.0.0.26.0.29.0.212.05.14.0.216.0.219.03]henicosane (PubChem CID 134979731) has the molecular formula C21H24Cl2
and a molecular weight of 347.33 g/mol. Its IUPAC name is 15,15-dichlorooctaspiro[2.0.0.0.26.0.29.0.212.05.14.0.216.0.219.03]henicosane.
Molecular Properties
| Compound Name | 15,15-dichlorooctaspiro[2.0.0.0.26.0.29.0.212.05.14.0.216.0.219.03]henicosane |
| PubChem CID | 134979731 |
| Molecular Formula | C21H24Cl2 |
| Molecular Weight | 347.33 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | 15,15-dichlorooctaspiro[2.0.0.0.26.0.29.0.212.05.14.0.216.0.219.03]henicosane |
| SMILES | ClC1(Cl)C2(C3(CC3)C3(CC3)C23CC3)C12C1(CC1)C1(CC1)C21CC1 |
| InChI | InChI=1S/C21H24Cl2/c22-21(23)19(15(5-6-15)13(1-2-13)16(19)7-8-16)20(21)17(9-10-17)14(3-4-14)18(20)11-12-18/h1-12H2 |
| InChIKey | NGNHFITXYVHBDJ-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 347.33 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 15,15-dichlorooctaspiro[2.0.0.0.26.0.29.0.212.05.14.0.216.0.219.03]henicosane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 15,15-dichlorooctaspiro[2.0.0.0.26.0.29.0.212.05.14.0.216.0.219.03]henicosane?
The IUPAC name of 15,15-dichlorooctaspiro[2.0.0.0.26.0.29.0.212.05.14.0.216.0.219.03]henicosane (CID 134979731) is 15,15-dichlorooctaspiro[2.0.0.0.26.0.29.0.212.05.14.0.216.0.219.03]henicosane.
What is the SMILES notation for 15,15-dichlorooctaspiro[2.0.0.0.26.0.29.0.212.05.14.0.216.0.219.03]henicosane?
The canonical SMILES for 15,15-dichlorooctaspiro[2.0.0.0.26.0.29.0.212.05.14.0.216.0.219.03]henicosane is ClC1(Cl)C2(C3(CC3)C3(CC3)C23CC3)C12C1(CC1)C1(CC1)C21CC1.
What is the InChIKey of 15,15-dichlorooctaspiro[2.0.0.0.26.0.29.0.212.05.14.0.216.0.219.03]henicosane?
The InChIKey is NGNHFITXYVHBDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24Cl2/c22-21(23)19(15(5-6-15)13(1-2-13)16(19)7-8-16)20(21)17(9-10-17)14(3-4-14)18(20)11-12-18/h1-12H2.
What are the key properties of 15,15-dichlorooctaspiro[2.0.0.0.26.0.29.0.212.05.14.0.216.0.219.03]henicosane?
15,15-dichlorooctaspiro[2.0.0.0.26.0.29.0.212.05.14.0.216.0.219.03]henicosane has a molecular weight of 347.33 g/mol, XLogP of 5.86, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 15,15-dichlorooctaspiro[2.0.0.0.26.0.29.0.212.05.14.0.216.0.219.03]henicosane is sourced from PubChem (CID 134979731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).