C21H37F3O2Si — CID 134979740
1-[(1E,3E)-5-[tert-butyl(dimethyl)silyl]oxy-3-(trifluoromethyl)penta-1,3-dienyl]-2,2,6-trimethylcyclohexan-1-ol (PubChem CID 134979740) has the molecular formula C21H37F3O2Si and a molecular weight of 406.61 g/mol. Its IUPAC name is 1-[(1E,3E)-5-[tert-butyl(dimethyl)silyl]oxy-3-(trifluoromethyl)penta-1,3-dienyl]-2,2,6-trimethylcyclohexan-1-ol.
| Compound Name | 1-[(1E,3E)-5-[tert-butyl(dimethyl)silyl]oxy-3-(trifluoromethyl)penta-1,3-dienyl]-2,2,6-trimethylcyclohexan-1-ol |
|---|---|
| PubChem CID | 134979740 |
| Molecular Formula | C21H37F3O2Si |
| Molecular Weight | 406.61 g/mol |
| Exact Mass | 406.25 |
| IUPAC Name | 1-[(1E,3E)-5-[tert-butyl(dimethyl)silyl]oxy-3-(trifluoromethyl)penta-1,3-dienyl]-2,2,6-trimethylcyclohexan-1-ol |
| SMILES | CC1CCCC(C)(C)C1(O)/C=C/C(=C\CO[Si](C)(C)C(C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C21H37F3O2Si/c1-16-10-9-13-19(5,6)20(16,25)14-11-17(21(22,23)24)12-15-26-27(7,8)18(2,3)4/h11-12,14,16,25H,9-10,13,15H2,1-8H3/b14-11+,17-12+ |
| InChIKey | BYTICKLFTVZGNA-DMAJYYCCSA-N |
| XLogP | 6.63 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.61 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|