C18H36O3Si — CID 134979829
(3E,5Z)-1-[tert-butyl(dimethyl)silyl]oxy-2,3,4-trimethylnona-3,5-diene-2,7-diol (PubChem CID 134979829) has the molecular formula C18H36O3Si and a molecular weight of 328.57 g/mol. Its IUPAC name is (3E,5Z)-1-[tert-butyl(dimethyl)silyl]oxy-2,3,4-trimethylnona-3,5-diene-2,7-diol.
| Compound Name | (3E,5Z)-1-[tert-butyl(dimethyl)silyl]oxy-2,3,4-trimethylnona-3,5-diene-2,7-diol |
|---|---|
| PubChem CID | 134979829 |
| Molecular Formula | C18H36O3Si |
| Molecular Weight | 328.57 g/mol |
| Exact Mass | 328.24 |
| IUPAC Name | (3E,5Z)-1-[tert-butyl(dimethyl)silyl]oxy-2,3,4-trimethylnona-3,5-diene-2,7-diol |
| SMILES | CCC(O)/C=C\C(C)=C(/C)C(C)(O)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H36O3Si/c1-10-16(19)12-11-14(2)15(3)18(7,20)13-21-22(8,9)17(4,5)6/h11-12,16,19-20H,10,13H2,1-9H3/b12-11-,15-14+ |
| InChIKey | JHJRNZNPNLOIOZ-GFHFAWEGSA-N |
| XLogP | 4.42 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.57 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|