C16H26O2Si — CID 134979842
1-[(1R,2R,4S)-1,6-dimethyl-5-trimethylsilyloxy-2-bicyclo[2.2.2]oct-5-enyl]prop-2-en-1-one (PubChem CID 134979842) has the molecular formula C16H26O2Si and a molecular weight of 278.47 g/mol. Its IUPAC name is 1-[(1R,2R,4S)-1,6-dimethyl-5-trimethylsilyloxy-2-bicyclo[2.2.2]oct-5-enyl]prop-2-en-1-one.
| Compound Name | 1-[(1R,2R,4S)-1,6-dimethyl-5-trimethylsilyloxy-2-bicyclo[2.2.2]oct-5-enyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 134979842 |
| Molecular Formula | C16H26O2Si |
| Molecular Weight | 278.47 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 1-[(1R,2R,4S)-1,6-dimethyl-5-trimethylsilyloxy-2-bicyclo[2.2.2]oct-5-enyl]prop-2-en-1-one |
| SMILES | C=CC(=O)[C@@H]1C[C@@H]2CC[C@@]1(C)C(C)=C2O[Si](C)(C)C |
| InChI | InChI=1S/C16H26O2Si/c1-7-14(17)13-10-12-8-9-16(13,3)11(2)15(12)18-19(4,5)6/h7,12-13H,1,8-10H2,2-6H3/t12-,13-,16-/m0/s1 |
| InChIKey | PDIBDSJYJLHWGQ-XEZPLFJOSA-N |
| XLogP | 4.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.47 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|