C14H10F8N2 — CID 134979848
4-phenyl-3,6-bis(1,2,2,2-tetrafluoroethyl)-1,4-dihydropyridazine (PubChem CID 134979848) has the molecular formula C14H10F8N2 and a molecular weight of 358.23 g/mol. Its IUPAC name is 4-phenyl-3,6-bis(1,2,2,2-tetrafluoroethyl)-1,4-dihydropyridazine.
| Compound Name | 4-phenyl-3,6-bis(1,2,2,2-tetrafluoroethyl)-1,4-dihydropyridazine |
|---|---|
| PubChem CID | 134979848 |
| Molecular Formula | C14H10F8N2 |
| Molecular Weight | 358.23 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | 4-phenyl-3,6-bis(1,2,2,2-tetrafluoroethyl)-1,4-dihydropyridazine |
| SMILES | FC(C1=CC(c2ccccc2)C(C(F)C(F)(F)F)=NN1)C(F)(F)F |
| InChI | InChI=1S/C14H10F8N2/c15-11(13(17,18)19)9-6-8(7-4-2-1-3-5-7)10(24-23-9)12(16)14(20,21)22/h1-6,8,11-12,23H |
| InChIKey | UXVLKPHGDGJOPZ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.23 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |