About [(2E)-1-(benzenesulfonyl)-3,6-dimethylhepta-2,5-dien-2-yl]sulfanylbenzene
[(2E)-1-(benzenesulfonyl)-3,6-dimethylhepta-2,5-dien-2-yl]sulfanylbenzene (PubChem CID 134979888) has the molecular formula C21H24O2S2
and a molecular weight of 372.56 g/mol. Its IUPAC name is [(2E)-1-(benzenesulfonyl)-3,6-dimethylhepta-2,5-dien-2-yl]sulfanylbenzene.
Molecular Properties
| Compound Name | [(2E)-1-(benzenesulfonyl)-3,6-dimethylhepta-2,5-dien-2-yl]sulfanylbenzene |
| PubChem CID | 134979888 |
| Molecular Formula | C21H24O2S2 |
| Molecular Weight | 372.56 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | [(2E)-1-(benzenesulfonyl)-3,6-dimethylhepta-2,5-dien-2-yl]sulfanylbenzene |
| SMILES | CC(C)=CC/C(C)=C(\CS(=O)(=O)c1ccccc1)Sc1ccccc1 |
| InChI | InChI=1S/C21H24O2S2/c1-17(2)14-15-18(3)21(24-19-10-6-4-7-11-19)16-25(22,23)20-12-8-5-9-13-20/h4-14H,15-16H2,1-3H3/b21-18+ |
| InChIKey | BNJMZECCHWWNRD-DYTRJAOYSA-N |
| XLogP | 5.88 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 372.56 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(2E)-1-(benzenesulfonyl)-3,6-dimethylhepta-2,5-dien-2-yl]sulfanylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2E)-1-(benzenesulfonyl)-3,6-dimethylhepta-2,5-dien-2-yl]sulfanylbenzene?
The IUPAC name of [(2E)-1-(benzenesulfonyl)-3,6-dimethylhepta-2,5-dien-2-yl]sulfanylbenzene (CID 134979888) is [(2E)-1-(benzenesulfonyl)-3,6-dimethylhepta-2,5-dien-2-yl]sulfanylbenzene.
What is the SMILES notation for [(2E)-1-(benzenesulfonyl)-3,6-dimethylhepta-2,5-dien-2-yl]sulfanylbenzene?
The canonical SMILES for [(2E)-1-(benzenesulfonyl)-3,6-dimethylhepta-2,5-dien-2-yl]sulfanylbenzene is CC(C)=CC/C(C)=C(\CS(=O)(=O)c1ccccc1)Sc1ccccc1.
What is the InChIKey of [(2E)-1-(benzenesulfonyl)-3,6-dimethylhepta-2,5-dien-2-yl]sulfanylbenzene?
The InChIKey is BNJMZECCHWWNRD-DYTRJAOYSA-N. The full InChI is InChI=1S/C21H24O2S2/c1-17(2)14-15-18(3)21(24-19-10-6-4-7-11-19)16-25(22,23)20-12-8-5-9-13-20/h4-14H,15-16H2,1-3H3/b21-18+.
What are the key properties of [(2E)-1-(benzenesulfonyl)-3,6-dimethylhepta-2,5-dien-2-yl]sulfanylbenzene?
[(2E)-1-(benzenesulfonyl)-3,6-dimethylhepta-2,5-dien-2-yl]sulfanylbenzene has a molecular weight of 372.56 g/mol, XLogP of 5.88, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2E)-1-(benzenesulfonyl)-3,6-dimethylhepta-2,5-dien-2-yl]sulfanylbenzene is sourced from PubChem (CID 134979888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).