C14H22O3Si — CID 134979942
(3aS,7aR)-5-triethylsilyl-3a,4,7,7a-tetrahydro-2-benzofuran-1,3-dione (PubChem CID 134979942) has the molecular formula C14H22O3Si and a molecular weight of 266.41 g/mol. Its IUPAC name is (3aS,7aR)-5-triethylsilyl-3a,4,7,7a-tetrahydro-2-benzofuran-1,3-dione.
| Compound Name | (3aS,7aR)-5-triethylsilyl-3a,4,7,7a-tetrahydro-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 134979942 |
| Molecular Formula | C14H22O3Si |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | (3aS,7aR)-5-triethylsilyl-3a,4,7,7a-tetrahydro-2-benzofuran-1,3-dione |
| SMILES | CC[Si](CC)(CC)C1=CC[C@H]2C(=O)OC(=O)[C@H]2C1 |
| InChI | InChI=1S/C14H22O3Si/c1-4-18(5-2,6-3)10-7-8-11-12(9-10)14(16)17-13(11)15/h7,11-12H,4-6,8-9H2,1-3H3/t11-,12+/m1/s1 |
| InChIKey | GMOOFYKXAMCARJ-NEPJUHHUSA-N |
| XLogP | 3.07 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|