C16H22O4 — CID 134979960
(4aR,8aS)-2-[(4aR,8aS)-2,4a,6,7,8,8a-hexahydropyrano[3,2-b]pyran-2-yl]-2,4a,6,7,8,8a-hexahydropyrano[3,2-b]pyran (PubChem CID 134979960) has the molecular formula C16H22O4 and a molecular weight of 278.35 g/mol. Its IUPAC name is (4aR,8aS)-2-[(4aR,8aS)-2,4a,6,7,8,8a-hexahydropyrano[3,2-b]pyran-2-yl]-2,4a,6,7,8,8a-hexahydropyrano[3,2-b]pyran.
| Compound Name | (4aR,8aS)-2-[(4aR,8aS)-2,4a,6,7,8,8a-hexahydropyrano[3,2-b]pyran-2-yl]-2,4a,6,7,8,8a-hexahydropyrano[3,2-b]pyran |
|---|---|
| PubChem CID | 134979960 |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | (4aR,8aS)-2-[(4aR,8aS)-2,4a,6,7,8,8a-hexahydropyrano[3,2-b]pyran-2-yl]-2,4a,6,7,8,8a-hexahydropyrano[3,2-b]pyran |
| SMILES | C1=C[C@H]2OCCC[C@@H]2OC1C1C=C[C@H]2OCCC[C@@H]2O1 |
| InChI | InChI=1S/C16H22O4/c1-3-13-11(17-9-1)5-7-15(19-13)16-8-6-12-14(20-16)4-2-10-18-12/h5-8,11-16H,1-4,9-10H2/t11-,12-,13+,14+,15?,16?/m1/s1 |
| InChIKey | RNBDWGHRZNGTCD-FVAZMBRWSA-N |
| XLogP | 1.99 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|