About [(1S,2S,3S)-1-chloro-2-methyl-3-propan-2-ylcyclopropyl]benzene
[(1S,2S,3S)-1-chloro-2-methyl-3-propan-2-ylcyclopropyl]benzene (PubChem CID 134980000) has the molecular formula C13H17Cl
and a molecular weight of 208.73 g/mol. Its IUPAC name is [(1S,2S,3S)-1-chloro-2-methyl-3-propan-2-ylcyclopropyl]benzene.
Molecular Properties
| Compound Name | [(1S,2S,3S)-1-chloro-2-methyl-3-propan-2-ylcyclopropyl]benzene |
| PubChem CID | 134980000 |
| Molecular Formula | C13H17Cl |
| Molecular Weight | 208.73 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | [(1S,2S,3S)-1-chloro-2-methyl-3-propan-2-ylcyclopropyl]benzene |
| SMILES | CC(C)[C@H]1[C@H](C)[C@@]1(Cl)c1ccccc1 |
| InChI | InChI=1S/C13H17Cl/c1-9(2)12-10(3)13(12,14)11-7-5-4-6-8-11/h4-10,12H,1-3H3/t10-,12-,13+/m0/s1 |
| InChIKey | BHOKLELRKGXGHB-WCFLWFBJSA-N |
| XLogP | 4.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.73 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze [(1S,2S,3S)-1-chloro-2-methyl-3-propan-2-ylcyclopropyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,2S,3S)-1-chloro-2-methyl-3-propan-2-ylcyclopropyl]benzene?
The IUPAC name of [(1S,2S,3S)-1-chloro-2-methyl-3-propan-2-ylcyclopropyl]benzene (CID 134980000) is [(1S,2S,3S)-1-chloro-2-methyl-3-propan-2-ylcyclopropyl]benzene.
What is the SMILES notation for [(1S,2S,3S)-1-chloro-2-methyl-3-propan-2-ylcyclopropyl]benzene?
The canonical SMILES for [(1S,2S,3S)-1-chloro-2-methyl-3-propan-2-ylcyclopropyl]benzene is CC(C)[C@H]1[C@H](C)[C@@]1(Cl)c1ccccc1.
What is the InChIKey of [(1S,2S,3S)-1-chloro-2-methyl-3-propan-2-ylcyclopropyl]benzene?
The InChIKey is BHOKLELRKGXGHB-WCFLWFBJSA-N. The full InChI is InChI=1S/C13H17Cl/c1-9(2)12-10(3)13(12,14)11-7-5-4-6-8-11/h4-10,12H,1-3H3/t10-,12-,13+/m0/s1.
What are the key properties of [(1S,2S,3S)-1-chloro-2-methyl-3-propan-2-ylcyclopropyl]benzene?
[(1S,2S,3S)-1-chloro-2-methyl-3-propan-2-ylcyclopropyl]benzene has a molecular weight of 208.73 g/mol, XLogP of 4.04, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,2S,3S)-1-chloro-2-methyl-3-propan-2-ylcyclopropyl]benzene is sourced from PubChem (CID 134980000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).