C19H32O3Si2 — CID 134980051
(4aS,8R,8aR)-6-methyl-8-trimethylsilyloxy-8a-(2-trimethylsilyloxyethynyl)-2,3,4,4a,5,8-hexahydronaphthalen-1-one (PubChem CID 134980051) has the molecular formula C19H32O3Si2 and a molecular weight of 364.63 g/mol. Its IUPAC name is (4aS,8R,8aR)-6-methyl-8-trimethylsilyloxy-8a-(2-trimethylsilyloxyethynyl)-2,3,4,4a,5,8-hexahydronaphthalen-1-one.
| Compound Name | (4aS,8R,8aR)-6-methyl-8-trimethylsilyloxy-8a-(2-trimethylsilyloxyethynyl)-2,3,4,4a,5,8-hexahydronaphthalen-1-one |
|---|---|
| PubChem CID | 134980051 |
| Molecular Formula | C19H32O3Si2 |
| Molecular Weight | 364.63 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | (4aS,8R,8aR)-6-methyl-8-trimethylsilyloxy-8a-(2-trimethylsilyloxyethynyl)-2,3,4,4a,5,8-hexahydronaphthalen-1-one |
| SMILES | CC1=C[C@@H](O[Si](C)(C)C)[C@@]2(C#CO[Si](C)(C)C)C(=O)CCC[C@H]2C1 |
| InChI | InChI=1S/C19H32O3Si2/c1-15-13-16-9-8-10-17(20)19(16,11-12-21-23(2,3)4)18(14-15)22-24(5,6)7/h14,16,18H,8-10,13H2,1-7H3/t16-,18+,19+/m0/s1 |
| InChIKey | ILLDIIXRLNUJEX-QXAKKESOSA-N |
| XLogP | 4.72 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.63 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|