C17H24O8 — CID 134980061
(1R,6E,12R,14R,15R)-14,15-dimethoxy-14,15-dimethyl-5-methylidene-3,10,13,16-tetraoxabicyclo[10.4.0]hexadec-6-ene-2,11-dione (PubChem CID 134980061) has the molecular formula C17H24O8 and a molecular weight of 356.37 g/mol. Its IUPAC name is (1R,6E,12R,14R,15R)-14,15-dimethoxy-14,15-dimethyl-5-methylidene-3,10,13,16-tetraoxabicyclo[10.4.0]hexadec-6-ene-2,11-dione.
| Compound Name | (1R,6E,12R,14R,15R)-14,15-dimethoxy-14,15-dimethyl-5-methylidene-3,10,13,16-tetraoxabicyclo[10.4.0]hexadec-6-ene-2,11-dione |
|---|---|
| PubChem CID | 134980061 |
| Molecular Formula | C17H24O8 |
| Molecular Weight | 356.37 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | (1R,6E,12R,14R,15R)-14,15-dimethoxy-14,15-dimethyl-5-methylidene-3,10,13,16-tetraoxabicyclo[10.4.0]hexadec-6-ene-2,11-dione |
| SMILES | C=C1/C=C/CCOC(=O)[C@@H]2O[C@@](C)(OC)[C@](C)(OC)O[C@H]2C(=O)OC1 |
| InChI | InChI=1S/C17H24O8/c1-11-8-6-7-9-22-14(18)12-13(15(19)23-10-11)25-17(3,21-5)16(2,20-4)24-12/h6,8,12-13H,1,7,9-10H2,2-5H3/b8-6+/t12-,13-,16-,17-/m1/s1 |
| InChIKey | QROYMPMFXRPDIQ-UZJZIBHDSA-N |
| XLogP | 1.10 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.37 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |