C17H20O9 — CID 134980079
[(1S,7R,8S,9R,11S)-9-tert-butyl-9-hydroxy-2,6,13-trioxo-3,5,12-trioxatetracyclo[6.6.0.01,11.04,8]tetradecan-7-yl] acetate (PubChem CID 134980079) has the molecular formula C17H20O9 and a molecular weight of 368.34 g/mol. Its IUPAC name is [(1S,7R,8S,9R,11S)-9-tert-butyl-9-hydroxy-2,6,13-trioxo-3,5,12-trioxatetracyclo[6.6.0.01,11.04,8]tetradecan-7-yl] acetate.
| Compound Name | [(1S,7R,8S,9R,11S)-9-tert-butyl-9-hydroxy-2,6,13-trioxo-3,5,12-trioxatetracyclo[6.6.0.01,11.04,8]tetradecan-7-yl] acetate |
|---|---|
| PubChem CID | 134980079 |
| Molecular Formula | C17H20O9 |
| Molecular Weight | 368.34 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | [(1S,7R,8S,9R,11S)-9-tert-butyl-9-hydroxy-2,6,13-trioxo-3,5,12-trioxatetracyclo[6.6.0.01,11.04,8]tetradecan-7-yl] acetate |
| SMILES | CC(=O)O[C@H]1C(=O)OC2OC(=O)[C@]34CC(=O)O[C@H]3C[C@@](O)(C(C)(C)C)[C@@]214 |
| InChI | InChI=1S/C17H20O9/c1-7(18)23-10-11(20)25-13-17(10)15(12(21)26-13)6-9(19)24-8(15)5-16(17,22)14(2,3)4/h8,10,13,22H,5-6H2,1-4H3/t8-,10-,13?,15-,16+,17+/m0/s1 |
| InChIKey | PMMDWUMUOHPJBV-PNKLKBQESA-N |
| XLogP | -0.17 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.34 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|