C9H14 — CID 134980109
(2S,5R)-2,5-dimethylbicyclo[4.1.0]hept-3-ene (PubChem CID 134980109) has the molecular formula C9H14 and a molecular weight of 122.21 g/mol. Its IUPAC name is (2S,5R)-2,5-dimethylbicyclo[4.1.0]hept-3-ene.
| Compound Name | (2S,5R)-2,5-dimethylbicyclo[4.1.0]hept-3-ene |
|---|---|
| PubChem CID | 134980109 |
| Molecular Formula | C9H14 |
| Molecular Weight | 122.21 g/mol |
| Exact Mass | 122.11 |
| IUPAC Name | (2S,5R)-2,5-dimethylbicyclo[4.1.0]hept-3-ene |
| SMILES | C[C@@H]1C=C[C@H](C)C2CC21 |
| InChI | InChI=1S/C9H14/c1-6-3-4-7(2)9-5-8(6)9/h3-4,6-9H,5H2,1-2H3/t6-,7+,8?,9? |
| InChIKey | MBTGHFWHQKBGRF-QPIHLSAKSA-N |
| XLogP | 2.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 122.21 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|