C16H26O5Si — CID 134980125
methyl (3S,3aR,7R,7aR)-5-ethyl-3-methyl-1-oxo-7-trimethylsilyloxy-3a,4,7,7a-tetrahydro-3H-2-benzofuran-4-carboxylate (PubChem CID 134980125) has the molecular formula C16H26O5Si and a molecular weight of 326.47 g/mol. Its IUPAC name is methyl (3S,3aR,7R,7aR)-5-ethyl-3-methyl-1-oxo-7-trimethylsilyloxy-3a,4,7,7a-tetrahydro-3H-2-benzofuran-4-carboxylate.
| Compound Name | methyl (3S,3aR,7R,7aR)-5-ethyl-3-methyl-1-oxo-7-trimethylsilyloxy-3a,4,7,7a-tetrahydro-3H-2-benzofuran-4-carboxylate |
|---|---|
| PubChem CID | 134980125 |
| Molecular Formula | C16H26O5Si |
| Molecular Weight | 326.47 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | methyl (3S,3aR,7R,7aR)-5-ethyl-3-methyl-1-oxo-7-trimethylsilyloxy-3a,4,7,7a-tetrahydro-3H-2-benzofuran-4-carboxylate |
| SMILES | CCC1=C[C@@H](O[Si](C)(C)C)[C@@H]2C(=O)O[C@@H](C)[C@@H]2C1C(=O)OC |
| InChI | InChI=1S/C16H26O5Si/c1-7-10-8-11(21-22(4,5)6)14-12(9(2)20-16(14)18)13(10)15(17)19-3/h8-9,11-14H,7H2,1-6H3/t9-,11+,12+,13?,14-/m0/s1 |
| InChIKey | AEMDADGFZOAIQJ-DKSMRYRPSA-N |
| XLogP | 2.52 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.47 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|