C16H22O7 — CID 134980128
5-[(1S,4R,5S,6R)-5,6-bis(methoxycarbonyl)-4-methyl-7-oxabicyclo[2.2.1]hept-2-en-1-yl]pentanoic acid (PubChem CID 134980128) has the molecular formula C16H22O7 and a molecular weight of 326.35 g/mol. Its IUPAC name is 5-[(1S,4R,5S,6R)-5,6-bis(methoxycarbonyl)-4-methyl-7-oxabicyclo[2.2.1]hept-2-en-1-yl]pentanoic acid.
| Compound Name | 5-[(1S,4R,5S,6R)-5,6-bis(methoxycarbonyl)-4-methyl-7-oxabicyclo[2.2.1]hept-2-en-1-yl]pentanoic acid |
|---|---|
| PubChem CID | 134980128 |
| Molecular Formula | C16H22O7 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | 5-[(1S,4R,5S,6R)-5,6-bis(methoxycarbonyl)-4-methyl-7-oxabicyclo[2.2.1]hept-2-en-1-yl]pentanoic acid |
| SMILES | COC(=O)[C@@H]1[C@H](C(=O)OC)[C@@]2(C)C=C[C@]1(CCCCC(=O)O)O2 |
| InChI | InChI=1S/C16H22O7/c1-15-8-9-16(23-15,7-5-4-6-10(17)18)12(14(20)22-3)11(15)13(19)21-2/h8-9,11-12H,4-7H2,1-3H3,(H,17,18)/t11-,12+,15-,16+/m1/s1 |
| InChIKey | STNBPAKTSAXAJM-KOZAUXTDSA-N |
| XLogP | 1.31 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|