About tert-butyl (1R,6S)-1-formyl-6-methyl-3-trimethylsilyloxycyclohex-3-ene-1-carboxylate
tert-butyl (1R,6S)-1-formyl-6-methyl-3-trimethylsilyloxycyclohex-3-ene-1-carboxylate (PubChem CID 134980145) has the molecular formula C16H28O4Si
and a molecular weight of 312.48 g/mol. Its IUPAC name is tert-butyl (1R,6S)-1-formyl-6-methyl-3-trimethylsilyloxycyclohex-3-ene-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl (1R,6S)-1-formyl-6-methyl-3-trimethylsilyloxycyclohex-3-ene-1-carboxylate |
| PubChem CID | 134980145 |
| Molecular Formula | C16H28O4Si |
| Molecular Weight | 312.48 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | tert-butyl (1R,6S)-1-formyl-6-methyl-3-trimethylsilyloxycyclohex-3-ene-1-carboxylate |
| SMILES | C[C@H]1CC=C(O[Si](C)(C)C)C[C@@]1(C=O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H28O4Si/c1-12-8-9-13(20-21(5,6)7)10-16(12,11-17)14(18)19-15(2,3)4/h9,11-12H,8,10H2,1-7H3/t12-,16-/m0/s1 |
| InChIKey | MQFXPTKPIUYFGF-LRDDRELGSA-N |
| XLogP | 3.68 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.48 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl (1R,6S)-1-formyl-6-methyl-3-trimethylsilyloxycyclohex-3-ene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (1R,6S)-1-formyl-6-methyl-3-trimethylsilyloxycyclohex-3-ene-1-carboxylate?
The IUPAC name of tert-butyl (1R,6S)-1-formyl-6-methyl-3-trimethylsilyloxycyclohex-3-ene-1-carboxylate (CID 134980145) is tert-butyl (1R,6S)-1-formyl-6-methyl-3-trimethylsilyloxycyclohex-3-ene-1-carboxylate.
What is the SMILES notation for tert-butyl (1R,6S)-1-formyl-6-methyl-3-trimethylsilyloxycyclohex-3-ene-1-carboxylate?
The canonical SMILES for tert-butyl (1R,6S)-1-formyl-6-methyl-3-trimethylsilyloxycyclohex-3-ene-1-carboxylate is C[C@H]1CC=C(O[Si](C)(C)C)C[C@@]1(C=O)C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl (1R,6S)-1-formyl-6-methyl-3-trimethylsilyloxycyclohex-3-ene-1-carboxylate?
The InChIKey is MQFXPTKPIUYFGF-LRDDRELGSA-N. The full InChI is InChI=1S/C16H28O4Si/c1-12-8-9-13(20-21(5,6)7)10-16(12,11-17)14(18)19-15(2,3)4/h9,11-12H,8,10H2,1-7H3/t12-,16-/m0/s1.
What are the key properties of tert-butyl (1R,6S)-1-formyl-6-methyl-3-trimethylsilyloxycyclohex-3-ene-1-carboxylate?
tert-butyl (1R,6S)-1-formyl-6-methyl-3-trimethylsilyloxycyclohex-3-ene-1-carboxylate has a molecular weight of 312.48 g/mol, XLogP of 3.68, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (1R,6S)-1-formyl-6-methyl-3-trimethylsilyloxycyclohex-3-ene-1-carboxylate is sourced from PubChem (CID 134980145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).