About ethyl (3Z)-4,5-bis(acetyloxymethyl)hexa-3,5-dienoate
ethyl (3Z)-4,5-bis(acetyloxymethyl)hexa-3,5-dienoate (PubChem CID 134980169) has the molecular formula C14H20O6
and a molecular weight of 284.31 g/mol. Its IUPAC name is ethyl (3Z)-4,5-bis(acetyloxymethyl)hexa-3,5-dienoate.
Molecular Properties
| Compound Name | ethyl (3Z)-4,5-bis(acetyloxymethyl)hexa-3,5-dienoate |
| PubChem CID | 134980169 |
| Molecular Formula | C14H20O6 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | ethyl (3Z)-4,5-bis(acetyloxymethyl)hexa-3,5-dienoate |
| SMILES | C=C(COC(C)=O)/C(=C/CC(=O)OCC)COC(C)=O |
| InChI | InChI=1S/C14H20O6/c1-5-18-14(17)7-6-13(9-20-12(4)16)10(2)8-19-11(3)15/h6H,2,5,7-9H2,1,3-4H3/b13-6+ |
| InChIKey | YWLYHGOKYSNHNP-AWNIVKPZSA-N |
| XLogP | 1.55 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethyl (3Z)-4,5-bis(acetyloxymethyl)hexa-3,5-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (3Z)-4,5-bis(acetyloxymethyl)hexa-3,5-dienoate?
The IUPAC name of ethyl (3Z)-4,5-bis(acetyloxymethyl)hexa-3,5-dienoate (CID 134980169) is ethyl (3Z)-4,5-bis(acetyloxymethyl)hexa-3,5-dienoate.
What is the SMILES notation for ethyl (3Z)-4,5-bis(acetyloxymethyl)hexa-3,5-dienoate?
The canonical SMILES for ethyl (3Z)-4,5-bis(acetyloxymethyl)hexa-3,5-dienoate is C=C(COC(C)=O)/C(=C/CC(=O)OCC)COC(C)=O.
What is the InChIKey of ethyl (3Z)-4,5-bis(acetyloxymethyl)hexa-3,5-dienoate?
The InChIKey is YWLYHGOKYSNHNP-AWNIVKPZSA-N. The full InChI is InChI=1S/C14H20O6/c1-5-18-14(17)7-6-13(9-20-12(4)16)10(2)8-19-11(3)15/h6H,2,5,7-9H2,1,3-4H3/b13-6+.
What are the key properties of ethyl (3Z)-4,5-bis(acetyloxymethyl)hexa-3,5-dienoate?
ethyl (3Z)-4,5-bis(acetyloxymethyl)hexa-3,5-dienoate has a molecular weight of 284.31 g/mol, XLogP of 1.55, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (3Z)-4,5-bis(acetyloxymethyl)hexa-3,5-dienoate is sourced from PubChem (CID 134980169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).