About 5-cyclopentyl-N,N-diethylpentanamide
5-cyclopentyl-N,N-diethylpentanamide (PubChem CID 134980179) has the molecular formula C14H27NO
and a molecular weight of 225.38 g/mol. Its IUPAC name is 5-cyclopentyl-N,N-diethylpentanamide.
Molecular Properties
| Compound Name | 5-cyclopentyl-N,N-diethylpentanamide |
| PubChem CID | 134980179 |
| Molecular Formula | C14H27NO |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.21 |
| IUPAC Name | 5-cyclopentyl-N,N-diethylpentanamide |
| SMILES | CCN(CC)C(=O)CCCCC1CCCC1 |
| InChI | InChI=1S/C14H27NO/c1-3-15(4-2)14(16)12-8-7-11-13-9-5-6-10-13/h13H,3-12H2,1-2H3 |
| InChIKey | FXDIZAHCBYOUJT-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-cyclopentyl-N,N-diethylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclopentyl-N,N-diethylpentanamide?
The IUPAC name of 5-cyclopentyl-N,N-diethylpentanamide (CID 134980179) is 5-cyclopentyl-N,N-diethylpentanamide.
What is the SMILES notation for 5-cyclopentyl-N,N-diethylpentanamide?
The canonical SMILES for 5-cyclopentyl-N,N-diethylpentanamide is CCN(CC)C(=O)CCCCC1CCCC1.
What is the InChIKey of 5-cyclopentyl-N,N-diethylpentanamide?
The InChIKey is FXDIZAHCBYOUJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27NO/c1-3-15(4-2)14(16)12-8-7-11-13-9-5-6-10-13/h13H,3-12H2,1-2H3.
What are the key properties of 5-cyclopentyl-N,N-diethylpentanamide?
5-cyclopentyl-N,N-diethylpentanamide has a molecular weight of 225.38 g/mol, XLogP of 3.61, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclopentyl-N,N-diethylpentanamide is sourced from PubChem (CID 134980179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).