C28H27F13O4 — CID 134980183
[(7R,8R,9S,13S,14S,17S)-3-acetyloxy-13-methyl-7-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate (PubChem CID 134980183) has the molecular formula C28H27F13O4 and a molecular weight of 674.49 g/mol. Its IUPAC name is [(7R,8R,9S,13S,14S,17S)-3-acetyloxy-13-methyl-7-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate.
| Compound Name | [(7R,8R,9S,13S,14S,17S)-3-acetyloxy-13-methyl-7-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate |
|---|---|
| PubChem CID | 134980183 |
| Molecular Formula | C28H27F13O4 |
| Molecular Weight | 674.49 g/mol |
| Exact Mass | 674.17 |
| IUPAC Name | [(7R,8R,9S,13S,14S,17S)-3-acetyloxy-13-methyl-7-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate |
| SMILES | CC(=O)Oc1ccc2c(c1)C[C@@H](C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](OC(C)=O)CC[C@@H]12 |
| InChI | InChI=1S/C28H27F13O4/c1-12(42)44-15-4-5-16-14(10-15)11-19(21-17(16)8-9-22(3)18(21)6-7-20(22)45-13(2)43)23(29,30)24(31,32)25(33,34)26(35,36)27(37,38)28(39,40)41/h4-5,10,17-21H,6-9,11H2,1-3H3/t17-,18+,19-,20+,21-,22+/m1/s1 |
| InChIKey | ABGYCTXUFBXJOF-VTJFTLGMSA-N |
| XLogP | 8.36 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.49 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|