About sodium 2-[(1S,6R)-6-(acetyloxymethyl)-6-methoxycarbonylcyclohex-2-en-1-yl]acetate
sodium 2-[(1S,6R)-6-(acetyloxymethyl)-6-methoxycarbonylcyclohex-2-en-1-yl]acetate (PubChem CID 134980234) has the molecular formula C13H17NaO6
and a molecular weight of 292.26 g/mol. Its IUPAC name is sodium 2-[(1S,6R)-6-(acetyloxymethyl)-6-methoxycarbonylcyclohex-2-en-1-yl]acetate.
Molecular Properties
| Compound Name | sodium 2-[(1S,6R)-6-(acetyloxymethyl)-6-methoxycarbonylcyclohex-2-en-1-yl]acetate |
| PubChem CID | 134980234 |
| Molecular Formula | C13H17NaO6 |
| Molecular Weight | 292.26 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | sodium 2-[(1S,6R)-6-(acetyloxymethyl)-6-methoxycarbonylcyclohex-2-en-1-yl]acetate |
| SMILES | COC(=O)[C@]1(COC(C)=O)CCC=C[C@@H]1CC(=O)[O-].[Na+] |
| InChI | InChI=1S/C13H18O6.Na/c1-9(14)19-8-13(12(17)18-2)6-4-3-5-10(13)7-11(15)16;/h3,5,10H,4,6-8H2,1-2H3,(H,15,16);/q;+1/p-1/t10-,13+;/m1./s1 |
| InChIKey | SWHXPWISUXVAFV-HTKOBJQYSA-M |
| XLogP | -3.18 |
| TPSA | 92.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.26 |
| LogP ≤ 5 | -3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze sodium 2-[(1S,6R)-6-(acetyloxymethyl)-6-methoxycarbonylcyclohex-2-en-1-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 2-[(1S,6R)-6-(acetyloxymethyl)-6-methoxycarbonylcyclohex-2-en-1-yl]acetate?
The IUPAC name of sodium 2-[(1S,6R)-6-(acetyloxymethyl)-6-methoxycarbonylcyclohex-2-en-1-yl]acetate (CID 134980234) is sodium 2-[(1S,6R)-6-(acetyloxymethyl)-6-methoxycarbonylcyclohex-2-en-1-yl]acetate.
What is the SMILES notation for sodium 2-[(1S,6R)-6-(acetyloxymethyl)-6-methoxycarbonylcyclohex-2-en-1-yl]acetate?
The canonical SMILES for sodium 2-[(1S,6R)-6-(acetyloxymethyl)-6-methoxycarbonylcyclohex-2-en-1-yl]acetate is COC(=O)[C@]1(COC(C)=O)CCC=C[C@@H]1CC(=O)[O-].[Na+].
What is the InChIKey of sodium 2-[(1S,6R)-6-(acetyloxymethyl)-6-methoxycarbonylcyclohex-2-en-1-yl]acetate?
The InChIKey is SWHXPWISUXVAFV-HTKOBJQYSA-M. The full InChI is InChI=1S/C13H18O6.Na/c1-9(14)19-8-13(12(17)18-2)6-4-3-5-10(13)7-11(15)16;/h3,5,10H,4,6-8H2,1-2H3,(H,15,16);/q;+1/p-1/t10-,13+;/m1./s1.
What are the key properties of sodium 2-[(1S,6R)-6-(acetyloxymethyl)-6-methoxycarbonylcyclohex-2-en-1-yl]acetate?
sodium 2-[(1S,6R)-6-(acetyloxymethyl)-6-methoxycarbonylcyclohex-2-en-1-yl]acetate has a molecular weight of 292.26 g/mol, XLogP of -3.18, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 2-[(1S,6R)-6-(acetyloxymethyl)-6-methoxycarbonylcyclohex-2-en-1-yl]acetate is sourced from PubChem (CID 134980234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).