C10H11F3O3 — CID 134980242
ethyl (1S,2S,3R,4R)-3-(trifluoromethyl)-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 134980242) has the molecular formula C10H11F3O3 and a molecular weight of 236.19 g/mol. Its IUPAC name is ethyl (1S,2S,3R,4R)-3-(trifluoromethyl)-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | ethyl (1S,2S,3R,4R)-3-(trifluoromethyl)-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 134980242 |
| Molecular Formula | C10H11F3O3 |
| Molecular Weight | 236.19 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | ethyl (1S,2S,3R,4R)-3-(trifluoromethyl)-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | CCOC(=O)[C@H]1[C@@H](C(F)(F)F)[C@H]2C=C[C@@H]1O2 |
| InChI | InChI=1S/C10H11F3O3/c1-2-15-9(14)7-5-3-4-6(16-5)8(7)10(11,12)13/h3-8H,2H2,1H3/t5-,6+,7+,8-/m0/s1 |
| InChIKey | DXXZUKJBQGYIAL-OSMVPFSASA-N |
| XLogP | 1.68 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.19 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|