C11H11ClO6 — CID 134980314
dimethyl (1R,4R,5R,6R)-8-chloro-3-oxo-2-oxabicyclo[2.2.2]oct-7-ene-5,6-dicarboxylate (PubChem CID 134980314) has the molecular formula C11H11ClO6 and a molecular weight of 274.66 g/mol. Its IUPAC name is dimethyl (1R,4R,5R,6R)-8-chloro-3-oxo-2-oxabicyclo[2.2.2]oct-7-ene-5,6-dicarboxylate.
| Compound Name | dimethyl (1R,4R,5R,6R)-8-chloro-3-oxo-2-oxabicyclo[2.2.2]oct-7-ene-5,6-dicarboxylate |
|---|---|
| PubChem CID | 134980314 |
| Molecular Formula | C11H11ClO6 |
| Molecular Weight | 274.66 g/mol |
| Exact Mass | 274.02 |
| IUPAC Name | dimethyl (1R,4R,5R,6R)-8-chloro-3-oxo-2-oxabicyclo[2.2.2]oct-7-ene-5,6-dicarboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H](C(=O)OC)[C@@H]2C(=O)O[C@H]1C=C2Cl |
| InChI | InChI=1S/C11H11ClO6/c1-16-9(13)7-5-3-4(12)6(11(15)18-5)8(7)10(14)17-2/h3,5-8H,1-2H3/t5-,6+,7-,8-/m0/s1 |
| InChIKey | PDXKXABAYWIZEV-YWIQKCBGSA-N |
| XLogP | 0.24 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.66 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|