C13H22O3 — CID 134980363
ethyl 4-[(3S,3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-3-yl]butanoate (PubChem CID 134980363) has the molecular formula C13H22O3 and a molecular weight of 226.32 g/mol. Its IUPAC name is ethyl 4-[(3S,3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-3-yl]butanoate.
| Compound Name | ethyl 4-[(3S,3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-3-yl]butanoate |
|---|---|
| PubChem CID | 134980363 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | ethyl 4-[(3S,3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-3-yl]butanoate |
| SMILES | CCOC(=O)CCC[C@@H]1CO[C@H]2CCC[C@@H]12 |
| InChI | InChI=1S/C13H22O3/c1-2-15-13(14)8-3-5-10-9-16-12-7-4-6-11(10)12/h10-12H,2-9H2,1H3/t10-,11+,12+/m1/s1 |
| InChIKey | NHACTGBIXLURHS-WOPDTQHZSA-N |
| XLogP | 2.53 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |