C15H19NO2S — CID 134980521
(1S,2R,6S)-2-methyl-6-[(R)-(4-methylphenyl)sulfinyl]cyclohex-3-ene-1-carboxamide (PubChem CID 134980521) has the molecular formula C15H19NO2S and a molecular weight of 277.39 g/mol. Its IUPAC name is (1S,2R,6S)-2-methyl-6-[(R)-(4-methylphenyl)sulfinyl]cyclohex-3-ene-1-carboxamide.
| Compound Name | (1S,2R,6S)-2-methyl-6-[(R)-(4-methylphenyl)sulfinyl]cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 134980521 |
| Molecular Formula | C15H19NO2S |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | (1S,2R,6S)-2-methyl-6-[(R)-(4-methylphenyl)sulfinyl]cyclohex-3-ene-1-carboxamide |
| SMILES | Cc1ccc([S@](=O)[C@H]2CC=C[C@@H](C)[C@H]2C(N)=O)cc1 |
| InChI | InChI=1S/C15H19NO2S/c1-10-6-8-12(9-7-10)19(18)13-5-3-4-11(2)14(13)15(16)17/h3-4,6-9,11,13-14H,5H2,1-2H3,(H2,16,17)/t11-,13+,14-,19+/m1/s1 |
| InChIKey | BKFUWQWNNKKPNV-KTFSFXJSSA-N |
| XLogP | 2.17 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|