C16H18OS — CID 134980534
(3aS,7aS)-5-methyl-7a-phenylsulfanyl-3,3a,4,7-tetrahydro-2H-inden-1-one (PubChem CID 134980534) has the molecular formula C16H18OS and a molecular weight of 258.39 g/mol. Its IUPAC name is (3aS,7aS)-5-methyl-7a-phenylsulfanyl-3,3a,4,7-tetrahydro-2H-inden-1-one.
| Compound Name | (3aS,7aS)-5-methyl-7a-phenylsulfanyl-3,3a,4,7-tetrahydro-2H-inden-1-one |
|---|---|
| PubChem CID | 134980534 |
| Molecular Formula | C16H18OS |
| Molecular Weight | 258.39 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | (3aS,7aS)-5-methyl-7a-phenylsulfanyl-3,3a,4,7-tetrahydro-2H-inden-1-one |
| SMILES | CC1=CC[C@@]2(Sc3ccccc3)C(=O)CC[C@H]2C1 |
| InChI | InChI=1S/C16H18OS/c1-12-9-10-16(13(11-12)7-8-15(16)17)18-14-5-3-2-4-6-14/h2-6,9,13H,7-8,10-11H2,1H3/t13-,16-/m0/s1 |
| InChIKey | HKWBODCRIODEOM-BBRMVZONSA-N |
| XLogP | 4.24 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.39 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|