C13H16O4 — CID 134980545
(4aS,8aS)-2,8a-dimethoxy-6-methyl-5,8-dihydro-4aH-naphthalene-1,4-dione (PubChem CID 134980545) has the molecular formula C13H16O4 and a molecular weight of 236.27 g/mol. Its IUPAC name is (4aS,8aS)-2,8a-dimethoxy-6-methyl-5,8-dihydro-4aH-naphthalene-1,4-dione.
| Compound Name | (4aS,8aS)-2,8a-dimethoxy-6-methyl-5,8-dihydro-4aH-naphthalene-1,4-dione |
|---|---|
| PubChem CID | 134980545 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | (4aS,8aS)-2,8a-dimethoxy-6-methyl-5,8-dihydro-4aH-naphthalene-1,4-dione |
| SMILES | COC1=CC(=O)[C@H]2CC(C)=CC[C@@]2(OC)C1=O |
| InChI | InChI=1S/C13H16O4/c1-8-4-5-13(17-3)9(6-8)10(14)7-11(16-2)12(13)15/h4,7,9H,5-6H2,1-3H3/t9-,13+/m1/s1 |
| InChIKey | JFUFAOWAMVXNGZ-RNCFNFMXSA-N |
| XLogP | 1.41 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|