C16H24O4Si — CID 134980546
(4aS,8R,8aS)-8-methoxy-3,8a-dimethyl-6-trimethylsilyloxy-5,8-dihydro-4aH-naphthalene-1,4-dione (PubChem CID 134980546) has the molecular formula C16H24O4Si and a molecular weight of 308.45 g/mol. Its IUPAC name is (4aS,8R,8aS)-8-methoxy-3,8a-dimethyl-6-trimethylsilyloxy-5,8-dihydro-4aH-naphthalene-1,4-dione.
| Compound Name | (4aS,8R,8aS)-8-methoxy-3,8a-dimethyl-6-trimethylsilyloxy-5,8-dihydro-4aH-naphthalene-1,4-dione |
|---|---|
| PubChem CID | 134980546 |
| Molecular Formula | C16H24O4Si |
| Molecular Weight | 308.45 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | (4aS,8R,8aS)-8-methoxy-3,8a-dimethyl-6-trimethylsilyloxy-5,8-dihydro-4aH-naphthalene-1,4-dione |
| SMILES | CO[C@@H]1C=C(O[Si](C)(C)C)C[C@@H]2C(=O)C(C)=CC(=O)[C@@]21C |
| InChI | InChI=1S/C16H24O4Si/c1-10-7-13(17)16(2)12(15(10)18)8-11(9-14(16)19-3)20-21(4,5)6/h7,9,12,14H,8H2,1-6H3/t12-,14-,16-/m1/s1 |
| InChIKey | ODYKUPJLAUOPSG-XNRPHZJLSA-N |
| XLogP | 2.86 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.45 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|