C18H30O6Si — CID 134980644
1-O-tert-butyl 2-O-ethyl (1R,2S)-1-formyl-4-trimethylsilyloxycyclohex-4-ene-1,2-dicarboxylate (PubChem CID 134980644) has the molecular formula C18H30O6Si and a molecular weight of 370.52 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-ethyl (1R,2S)-1-formyl-4-trimethylsilyloxycyclohex-4-ene-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-ethyl (1R,2S)-1-formyl-4-trimethylsilyloxycyclohex-4-ene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 134980644 |
| Molecular Formula | C18H30O6Si |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | 1-O-tert-butyl 2-O-ethyl (1R,2S)-1-formyl-4-trimethylsilyloxycyclohex-4-ene-1,2-dicarboxylate |
| SMILES | CCOC(=O)[C@H]1CC(O[Si](C)(C)C)=CC[C@@]1(C=O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H30O6Si/c1-8-22-15(20)14-11-13(24-25(5,6)7)9-10-18(14,12-19)16(21)23-17(2,3)4/h9,12,14H,8,10-11H2,1-7H3/t14-,18+/m1/s1 |
| InChIKey | VZQHZAOSJMCLAT-KDOFPFPSSA-N |
| XLogP | 3.22 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|