About dimethyl (1S,2R)-4-methoxy-5-phenylsulfanylcyclohex-4-ene-1,2-dicarboxylate
dimethyl (1S,2R)-4-methoxy-5-phenylsulfanylcyclohex-4-ene-1,2-dicarboxylate (PubChem CID 134980657) has the molecular formula C17H20O5S
and a molecular weight of 336.41 g/mol. Its IUPAC name is dimethyl (1S,2R)-4-methoxy-5-phenylsulfanylcyclohex-4-ene-1,2-dicarboxylate.
Molecular Properties
| Compound Name | dimethyl (1S,2R)-4-methoxy-5-phenylsulfanylcyclohex-4-ene-1,2-dicarboxylate |
| PubChem CID | 134980657 |
| Molecular Formula | C17H20O5S |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | dimethyl (1S,2R)-4-methoxy-5-phenylsulfanylcyclohex-4-ene-1,2-dicarboxylate |
| SMILES | COC(=O)[C@H]1CC(Sc2ccccc2)=C(OC)C[C@H]1C(=O)OC |
| InChI | InChI=1S/C17H20O5S/c1-20-14-9-12(16(18)21-2)13(17(19)22-3)10-15(14)23-11-7-5-4-6-8-11/h4-8,12-13H,9-10H2,1-3H3/t12-,13+/m1/s1 |
| InChIKey | WRDNCEIRKAKMJE-OLZOCXBDSA-N |
| XLogP | 3.01 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze dimethyl (1S,2R)-4-methoxy-5-phenylsulfanylcyclohex-4-ene-1,2-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl (1S,2R)-4-methoxy-5-phenylsulfanylcyclohex-4-ene-1,2-dicarboxylate?
The IUPAC name of dimethyl (1S,2R)-4-methoxy-5-phenylsulfanylcyclohex-4-ene-1,2-dicarboxylate (CID 134980657) is dimethyl (1S,2R)-4-methoxy-5-phenylsulfanylcyclohex-4-ene-1,2-dicarboxylate.
What is the SMILES notation for dimethyl (1S,2R)-4-methoxy-5-phenylsulfanylcyclohex-4-ene-1,2-dicarboxylate?
The canonical SMILES for dimethyl (1S,2R)-4-methoxy-5-phenylsulfanylcyclohex-4-ene-1,2-dicarboxylate is COC(=O)[C@H]1CC(Sc2ccccc2)=C(OC)C[C@H]1C(=O)OC.
What is the InChIKey of dimethyl (1S,2R)-4-methoxy-5-phenylsulfanylcyclohex-4-ene-1,2-dicarboxylate?
The InChIKey is WRDNCEIRKAKMJE-OLZOCXBDSA-N. The full InChI is InChI=1S/C17H20O5S/c1-20-14-9-12(16(18)21-2)13(17(19)22-3)10-15(14)23-11-7-5-4-6-8-11/h4-8,12-13H,9-10H2,1-3H3/t12-,13+/m1/s1.
What are the key properties of dimethyl (1S,2R)-4-methoxy-5-phenylsulfanylcyclohex-4-ene-1,2-dicarboxylate?
dimethyl (1S,2R)-4-methoxy-5-phenylsulfanylcyclohex-4-ene-1,2-dicarboxylate has a molecular weight of 336.41 g/mol, XLogP of 3.01, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl (1S,2R)-4-methoxy-5-phenylsulfanylcyclohex-4-ene-1,2-dicarboxylate is sourced from PubChem (CID 134980657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).