C29H52O5Si2 — CID 134980669
(1R,4S,13R,14S)-13-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-9,10,12-trimethylidene-5,15-dioxabicyclo[12.1.0]pentadecan-6-one (PubChem CID 134980669) has the molecular formula C29H52O5Si2 and a molecular weight of 536.90 g/mol. Its IUPAC name is (1R,4S,13R,14S)-13-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-9,10,12-trimethylidene-5,15-dioxabicyclo[12.1.0]pentadecan-6-one.
| Compound Name | (1R,4S,13R,14S)-13-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-9,10,12-trimethylidene-5,15-dioxabicyclo[12.1.0]pentadecan-6-one |
|---|---|
| PubChem CID | 134980669 |
| Molecular Formula | C29H52O5Si2 |
| Molecular Weight | 536.90 g/mol |
| Exact Mass | 536.34 |
| IUPAC Name | (1R,4S,13R,14S)-13-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-9,10,12-trimethylidene-5,15-dioxabicyclo[12.1.0]pentadecan-6-one |
| SMILES | C=C1CCC(=O)O[C@H](CO[Si](C)(C)C(C)(C)C)CC[C@H]2O[C@@H]2[C@H](O[Si](C)(C)C(C)(C)C)C(=C)CC1=C |
| InChI | InChI=1S/C29H52O5Si2/c1-20-14-17-25(30)32-23(19-31-35(10,11)28(4,5)6)15-16-24-27(33-24)26(22(3)18-21(20)2)34-36(12,13)29(7,8)9/h23-24,26-27H,1-3,14-19H2,4-13H3/t23-,24+,26+,27-/m0/s1 |
| InChIKey | WPRYJIYRWXASHW-NAUAGNGCSA-N |
| XLogP | 7.71 |
| TPSA | 57.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.90 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|