C13H21NO2 — CID 134980713
methyl (5R,6R)-5-methyl-6-pyrrolidin-1-ylcyclohex-2-ene-1-carboxylate (PubChem CID 134980713) has the molecular formula C13H21NO2 and a molecular weight of 223.32 g/mol. Its IUPAC name is methyl (5R,6R)-5-methyl-6-pyrrolidin-1-ylcyclohex-2-ene-1-carboxylate.
| Compound Name | methyl (5R,6R)-5-methyl-6-pyrrolidin-1-ylcyclohex-2-ene-1-carboxylate |
|---|---|
| PubChem CID | 134980713 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | methyl (5R,6R)-5-methyl-6-pyrrolidin-1-ylcyclohex-2-ene-1-carboxylate |
| SMILES | COC(=O)C1C=CC[C@@H](C)[C@H]1N1CCCC1 |
| InChI | InChI=1S/C13H21NO2/c1-10-6-5-7-11(13(15)16-2)12(10)14-8-3-4-9-14/h5,7,10-12H,3-4,6,8-9H2,1-2H3/t10-,11?,12-/m1/s1 |
| InChIKey | JATONDZUSKUMQE-IGBJHFKCSA-N |
| XLogP | 1.84 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|