C21H30O2 — CID 134980755
methyl (3S,3aR)-3a,5a-dimethyl-3-propan-2-yl-3,4,5,6,7,8-hexahydrobenzo[f]azulene-9-carboxylate (PubChem CID 134980755) has the molecular formula C21H30O2 and a molecular weight of 314.47 g/mol. Its IUPAC name is methyl (3S,3aR)-3a,5a-dimethyl-3-propan-2-yl-3,4,5,6,7,8-hexahydrobenzo[f]azulene-9-carboxylate.
| Compound Name | methyl (3S,3aR)-3a,5a-dimethyl-3-propan-2-yl-3,4,5,6,7,8-hexahydrobenzo[f]azulene-9-carboxylate |
|---|---|
| PubChem CID | 134980755 |
| Molecular Formula | C21H30O2 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | methyl (3S,3aR)-3a,5a-dimethyl-3-propan-2-yl-3,4,5,6,7,8-hexahydrobenzo[f]azulene-9-carboxylate |
| SMILES | COC(=O)C1=C2C=C3C=C[C@H](C(C)C)[C@@]3(C)CCC2(C)CCC1 |
| InChI | InChI=1S/C21H30O2/c1-14(2)17-9-8-15-13-18-16(19(22)23-5)7-6-10-20(18,3)11-12-21(15,17)4/h8-9,13-14,17H,6-7,10-12H2,1-5H3/t17-,20?,21+/m1/s1 |
| InChIKey | AHUVGIKCOROKER-LYHOZKKVSA-N |
| XLogP | 5.21 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |