C18H26O7 — CID 134980806
dimethyl (1S,2S,3R,4R)-1-(5-ethoxy-5-oxopentyl)-4-methyl-7-oxabicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate (PubChem CID 134980806) has the molecular formula C18H26O7 and a molecular weight of 354.40 g/mol. Its IUPAC name is dimethyl (1S,2S,3R,4R)-1-(5-ethoxy-5-oxopentyl)-4-methyl-7-oxabicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate.
| Compound Name | dimethyl (1S,2S,3R,4R)-1-(5-ethoxy-5-oxopentyl)-4-methyl-7-oxabicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 134980806 |
| Molecular Formula | C18H26O7 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | dimethyl (1S,2S,3R,4R)-1-(5-ethoxy-5-oxopentyl)-4-methyl-7-oxabicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
| SMILES | CCOC(=O)CCCC[C@@]12C=C[C@@](C)(O1)[C@H](C(=O)OC)[C@@H]2C(=O)OC |
| InChI | InChI=1S/C18H26O7/c1-5-24-12(19)8-6-7-9-18-11-10-17(2,25-18)13(15(20)22-3)14(18)16(21)23-4/h10-11,13-14H,5-9H2,1-4H3/t13-,14+,17+,18-/m0/s1 |
| InChIKey | TWCIMRDXMQCAGA-JFTQMJAMSA-N |
| XLogP | 1.79 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|