C19H19ClO3S — CID 134980841
(4aR,8aS)-2-chloro-6,7-dimethyl-3-[(S)-(4-methylphenyl)sulfinyl]-4a,5,8,8a-tetrahydronaphthalene-1,4-dione (PubChem CID 134980841) has the molecular formula C19H19ClO3S and a molecular weight of 362.88 g/mol. Its IUPAC name is (4aR,8aS)-2-chloro-6,7-dimethyl-3-[(S)-(4-methylphenyl)sulfinyl]-4a,5,8,8a-tetrahydronaphthalene-1,4-dione.
| Compound Name | (4aR,8aS)-2-chloro-6,7-dimethyl-3-[(S)-(4-methylphenyl)sulfinyl]-4a,5,8,8a-tetrahydronaphthalene-1,4-dione |
|---|---|
| PubChem CID | 134980841 |
| Molecular Formula | C19H19ClO3S |
| Molecular Weight | 362.88 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | (4aR,8aS)-2-chloro-6,7-dimethyl-3-[(S)-(4-methylphenyl)sulfinyl]-4a,5,8,8a-tetrahydronaphthalene-1,4-dione |
| SMILES | CC1=C(C)C[C@H]2C(=O)C([S@@](=O)c3ccc(C)cc3)=C(Cl)C(=O)[C@H]2C1 |
| InChI | InChI=1S/C19H19ClO3S/c1-10-4-6-13(7-5-10)24(23)19-16(20)17(21)14-8-11(2)12(3)9-15(14)18(19)22/h4-7,14-15H,8-9H2,1-3H3/t14-,15+,24-/m0/s1 |
| InChIKey | GITPZROPOXNVTA-OWWKKJFISA-N |
| XLogP | 4.07 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.88 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|