C15H24O2 — CID 134980862
(8R,8aS)-8-ethenyl-8a-(hydroxymethyl)-4,4-dimethyl-3,4a,5,6,7,8-hexahydro-2H-naphthalen-1-one (PubChem CID 134980862) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is (8R,8aS)-8-ethenyl-8a-(hydroxymethyl)-4,4-dimethyl-3,4a,5,6,7,8-hexahydro-2H-naphthalen-1-one.
| Compound Name | (8R,8aS)-8-ethenyl-8a-(hydroxymethyl)-4,4-dimethyl-3,4a,5,6,7,8-hexahydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 134980862 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | (8R,8aS)-8-ethenyl-8a-(hydroxymethyl)-4,4-dimethyl-3,4a,5,6,7,8-hexahydro-2H-naphthalen-1-one |
| SMILES | C=C[C@H]1CCCC2C(C)(C)CCC(=O)[C@]21CO |
| InChI | InChI=1S/C15H24O2/c1-4-11-6-5-7-12-14(2,3)9-8-13(17)15(11,12)10-16/h4,11-12,16H,1,5-10H2,2-3H3/t11-,12?,15-/m0/s1 |
| InChIKey | AMJDWMXLRWVHMG-BQELKBSMSA-N |
| XLogP | 2.96 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|