About carbanide;2-dimethylphosphanylethyl(dimethyl)phosphane;trichloronobelium
carbanide;2-dimethylphosphanylethyl(dimethyl)phosphane;trichloronobelium (PubChem CID 134981073) has the molecular formula C7H19Cl3NoP2-
and a molecular weight of 530.54 g/mol. Its IUPAC name is carbanide;2-dimethylphosphanylethyl(dimethyl)phosphane;trichloronobelium.
Molecular Properties
| Compound Name | carbanide;2-dimethylphosphanylethyl(dimethyl)phosphane;trichloronobelium |
| PubChem CID | 134981073 |
| Molecular Formula | C7H19Cl3NoP2- |
| Molecular Weight | 530.54 g/mol |
| Exact Mass | 529.10 |
| IUPAC Name | carbanide;2-dimethylphosphanylethyl(dimethyl)phosphane;trichloronobelium |
| SMILES | CP(C)CCP(C)C.Cl[No](Cl)Cl.[CH3-] |
| InChI | InChI=1S/C6H16P2.CH3.3ClH.No/c1-7(2)5-6-8(3)4;;;;;/h5-6H2,1-4H3;1H3;3*1H;/q;-1;;;;+3/p-3 |
| InChIKey | APAVWGHTGZYOED-UHFFFAOYSA-K |
| XLogP | 4.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 530.54 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze carbanide;2-dimethylphosphanylethyl(dimethyl)phosphane;trichloronobelium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;2-dimethylphosphanylethyl(dimethyl)phosphane;trichloronobelium?
The IUPAC name of carbanide;2-dimethylphosphanylethyl(dimethyl)phosphane;trichloronobelium (CID 134981073) is carbanide;2-dimethylphosphanylethyl(dimethyl)phosphane;trichloronobelium.
What is the SMILES notation for carbanide;2-dimethylphosphanylethyl(dimethyl)phosphane;trichloronobelium?
The canonical SMILES for carbanide;2-dimethylphosphanylethyl(dimethyl)phosphane;trichloronobelium is CP(C)CCP(C)C.Cl[No](Cl)Cl.[CH3-].
What is the InChIKey of carbanide;2-dimethylphosphanylethyl(dimethyl)phosphane;trichloronobelium?
The InChIKey is APAVWGHTGZYOED-UHFFFAOYSA-K. The full InChI is InChI=1S/C6H16P2.CH3.3ClH.No/c1-7(2)5-6-8(3)4;;;;;/h5-6H2,1-4H3;1H3;3*1H;/q;-1;;;;+3/p-3.
What are the key properties of carbanide;2-dimethylphosphanylethyl(dimethyl)phosphane;trichloronobelium?
carbanide;2-dimethylphosphanylethyl(dimethyl)phosphane;trichloronobelium has a molecular weight of 530.54 g/mol, XLogP of 4.99, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;2-dimethylphosphanylethyl(dimethyl)phosphane;trichloronobelium is sourced from PubChem (CID 134981073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).