C10H12O3 — CID 134981106
methyl (3aS,6aS)-2-methyl-4,6a-dihydro-3aH-cyclopenta[b]furan-3-carboxylate (PubChem CID 134981106) has the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. Its IUPAC name is methyl (3aS,6aS)-2-methyl-4,6a-dihydro-3aH-cyclopenta[b]furan-3-carboxylate.
| Compound Name | methyl (3aS,6aS)-2-methyl-4,6a-dihydro-3aH-cyclopenta[b]furan-3-carboxylate |
|---|---|
| PubChem CID | 134981106 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | methyl (3aS,6aS)-2-methyl-4,6a-dihydro-3aH-cyclopenta[b]furan-3-carboxylate |
| SMILES | COC(=O)C1=C(C)O[C@H]2C=CC[C@@H]12 |
| InChI | InChI=1S/C10H12O3/c1-6-9(10(11)12-2)7-4-3-5-8(7)13-6/h3,5,7-8H,4H2,1-2H3/t7-,8+/m1/s1 |
| InChIKey | ZCJCQHFFMTYSPD-SFYZADRCSA-N |
| XLogP | 1.41 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|