About CID 134981237
CID 134981237 (PubChem CID 134981237) has the molecular formula C11H15O2Rh
and a molecular weight of 282.15 g/mol.
Molecular Properties
| Compound Name | CID 134981237 |
| PubChem CID | 134981237 |
| Molecular Formula | C11H15O2Rh |
| Molecular Weight | 282.15 g/mol |
| Exact Mass | 282.01 |
| IUPAC Name | — |
| SMILES | C=C.C=C.COC(=O)C1=C[CH]C=C1.[Rh] |
| InChI | InChI=1S/C7H7O2.2C2H4.Rh/c1-9-7(8)6-4-2-3-5-6;2*1-2;/h2-5H,1H3;2*1-2H2; |
| InChIKey | CRXNEXMOYZMFIH-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.15 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze CID 134981237 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 134981237?
The IUPAC name of CID 134981237 (CID 134981237) is not available.
What is the SMILES notation for CID 134981237?
The canonical SMILES for CID 134981237 is C=C.C=C.COC(=O)C1=C[CH]C=C1.[Rh].
What is the InChIKey of CID 134981237?
The InChIKey is CRXNEXMOYZMFIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7O2.2C2H4.Rh/c1-9-7(8)6-4-2-3-5-6;2*1-2;/h2-5H,1H3;2*1-2H2;.
What are the key properties of CID 134981237?
CID 134981237 has a molecular weight of 282.15 g/mol, XLogP of 2.46, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 134981237 is sourced from PubChem (CID 134981237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).