C10H24O3Si — CID 134981275
(1R,2R,3R)-1-[tert-butyl(dimethyl)silyl]butane-1,2,3-triol (PubChem CID 134981275) has the molecular formula C10H24O3Si and a molecular weight of 220.38 g/mol. Its IUPAC name is (1R,2R,3R)-1-[tert-butyl(dimethyl)silyl]butane-1,2,3-triol.
| Compound Name | (1R,2R,3R)-1-[tert-butyl(dimethyl)silyl]butane-1,2,3-triol |
|---|---|
| PubChem CID | 134981275 |
| Molecular Formula | C10H24O3Si |
| Molecular Weight | 220.38 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | (1R,2R,3R)-1-[tert-butyl(dimethyl)silyl]butane-1,2,3-triol |
| SMILES | C[C@@H](O)[C@@H](O)[C@H](O)[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C10H24O3Si/c1-7(11)8(12)9(13)14(5,6)10(2,3)4/h7-9,11-13H,1-6H3/t7-,8-,9-/m1/s1 |
| InChIKey | OGLRFUQETVAUPE-IWSPIJDZSA-N |
| XLogP | 1.14 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.38 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|